ChemNet > CAS > 78291-99-3 2,3-Dihydroimidazo[2,1-b]benzothiazol-6-amine
78291-99-3 2,3-Dihydroimidazo[2,1-b]benzothiazol-6-amine
| product Name |
2,3-Dihydroimidazo[2,1-b]benzothiazol-6-amine |
| CAS No |
78291-99-3 |
| Synonyms |
2,3-Dihydroimidazo[2,1-b][1,3]benzothiazol-6-amine |
| Molecular Formula |
C9H9N3S |
| Molecular Weight |
191.2529 |
| InChI |
InChI=1/C9H9N3S/c10-6-1-2-8-7(5-6)12-4-3-11-9(12)13-8/h1-2,5H,3-4,10H2 |
| EINECS |
278-892-8 |
| Molecular Structure |
|
| Density |
1.61g/cm3 |
| Melting point |
200-205℃ |
| Boiling point |
430.6°C at 760 mmHg |
| Refractive index |
1.852 |
| Flash point |
214.2°C |
| Vapour Pressur |
1.29E-07mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|